CAS 1899039-20-3 appears in our catalog under these names: 4'-Hydroxyazobenzene-4-carboxylic acid hydrate, 97%, 4'-Hydroxyazobenzene-4-carboxylic acid hydrate. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 5g, 250mg, 1g, 50mg.
4-[(4-hydroxyphenyl)diazenyl]benzoic acid;hydrate (CAS 1899039-20-3) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: 4-[(4-hydroxyphenyl)diazenyl]benzoic acid;hydrate. InChIKey: FQUHDGIIJXMVAX-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 4-[(4-hydroxyphenyl)diazenyl]benzoic acid;hydrate |
| InChIKey | FQUHDGIIJXMVAX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N=NC2=CC=C(C=C2)O.O |
Computed by PubChem (NCBI)