Products 1063733-81-2
CAS 1063733-81-2 appears in our catalog under these names: 2-(3,5-Difluorophenyl)propan-2-amine hydrochloride, 98%, 2-(3，5-Difluorophenyl)propan-2-amine hydrochloride, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
2-(3,5-difluorophenyl)propan-2-amine;hydrochloride (CAS 1063733-81-2) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: 2-(3,5-difluorophenyl)propan-2-amine;hydrochloride. InChIKey: QCIVXXIYXGRXBO-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)propan-2-amine;hydrochloride |
| InChIKey | QCIVXXIYXGRXBO-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC(=C1)F)F)N.Cl |
Computed by PubChem (NCBI)