CAS 1063995-54-9 appears in our catalog under these names: 3-(7-Nitro-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 98%, Lenalidomide Impurity 37. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-nitro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 1063995-54-9) is a chemical compound with the molecular formula C13H11N3O5 and a molecular weight of 289.24 g/mol. IUPAC name: 3-(4-nitro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: QXMIBFXPGQHNCP-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O5 |
|---|---|
| Molecular weight | 289.24 g/mol |
| IUPAC name | 3-(4-nitro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | QXMIBFXPGQHNCP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)