CAS 460741-57-5 is the registry number for 2-(2,6-Dioxo-3-hydroxypiperidin-5-yl)-4-aminoisoindoline-1,3-dione. Offered by: TRC. Available pack sizes: 5mg.
4-amino-2-(5-hydroxy-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 460741-57-5) is a chemical compound with the molecular formula C13H11N3O5 and a molecular weight of 289.24 g/mol. IUPAC name: 4-amino-2-(5-hydroxy-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: SUPXDAFBRRQSKI-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O5 |
|---|---|
| Molecular weight | 289.24 g/mol |
| IUPAC name | 4-amino-2-(5-hydroxy-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | SUPXDAFBRRQSKI-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC(=O)C1O)N2C(=O)C3=C(C2=O)C(=CC=C3)N |
Computed by PubChem (NCBI)