CAS 827026-45-9 appears in our catalog under these names: (3S)-3-(4-Nitro-1-oxo-1,3-dihydro-2h-isoindol-2-yl)piperidine-2,6-dione, 95%, 3-(4-Nitro-1-oxo-1,3-dihydroisoindol-2-yl)piperidine-2,6-dione, 97%, Lenalidomide Impurity 28, Lenalidomide Impurity 46, 4-Nitro Lenalidomide, >95% (HPLC). Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 250mg, 25g, 1g, 5g, on request, 100mg, 10mg, 25mg.
3-(7-nitro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 827026-45-9) is a chemical compound with the molecular formula C13H11N3O5 and a molecular weight of 289.24 g/mol. IUPAC name: 3-(7-nitro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: JKPJLYIGKKDZDT-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O5 |
|---|---|
| Molecular weight | 289.24 g/mol |
| IUPAC name | 3-(7-nitro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | JKPJLYIGKKDZDT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)