Products 1547162-44-6
CAS 1547162-44-6 appears in our catalog under these names: Pomalidomide–6–OH, Pomalidomide-6-OH, 98%, Pomalidomide-6-OH, 98.09%, Pomalidomide-6-OH, 98%, 98%. Offered by: GLPBio, AmBeed, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 25mg, 100mg, 50mg, 50 mg, 10 mg, 5 mg.
4-amino-2-(2,6-dioxopiperidin-3-yl)-6-hydroxyisoindole-1,3-dione (CAS 1547162-44-6) is a chemical compound with the molecular formula C13H11N3O5 and a molecular weight of 289.24 g/mol. IUPAC name: 4-amino-2-(2,6-dioxopiperidin-3-yl)-6-hydroxyisoindole-1,3-dione. InChIKey: HBPNHPWPUQVWIY-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O5 |
|---|---|
| Molecular weight | 289.24 g/mol |
| IUPAC name | 4-amino-2-(2,6-dioxopiperidin-3-yl)-6-hydroxyisoindole-1,3-dione |
| InChIKey | HBPNHPWPUQVWIY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC(=C3)O)N |
Computed by PubChem (NCBI)