CAS 1547162-46-8 appears in our catalog under these names: Pomalidomide Impurity 19, Pomalidomide M16, CC–17369, CC-17369 99%, 4-amino-2-(2,6-dioxopiperidin-3-yl)-7-hydroxy-2,3-dihydro-1H-isoindole-1,3-dione, 98%, 98%. Offered by: Chemat Brand, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 25mg, 10mg, 5mg, 50mg, 100mg, 250mg, 1g.
4-amino-2-(2,6-dioxopiperidin-3-yl)-7-hydroxyisoindole-1,3-dione (CAS 1547162-46-8) is a chemical compound with the molecular formula C13H11N3O5 and a molecular weight of 289.24 g/mol. IUPAC name: 4-amino-2-(2,6-dioxopiperidin-3-yl)-7-hydroxyisoindole-1,3-dione. InChIKey: DNODJHQYSZVNMH-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O5 |
|---|---|
| Molecular weight | 289.24 g/mol |
| IUPAC name | 4-amino-2-(2,6-dioxopiperidin-3-yl)-7-hydroxyisoindole-1,3-dione |
| InChIKey | DNODJHQYSZVNMH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C=CC(=C3C2=O)O)N |
Computed by PubChem (NCBI)