CAS 106449-56-3 appears in our catalog under these names: 2'-Deoxyisoguanosine, 95%, 2’-Deoxyisoguanosine, >95% (HPLC), 2’-Deoxyisoguanosine, 2'-Deoxyisoguanosine 95%, 2′-Deoxy-2,3-dihydro-2-oxoadenosine, 95%, 95%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 10mg, 50mg, 0,25g, 0,1g, 0,5g.
6-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-2-one (CAS 106449-56-3) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 267.24 g/mol. IUPAC name: 6-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-2-one. InChIKey: SWFIFWZFCNRPBN-KVQBGUIXSA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 6-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-2-one |
| InChIKey | SWFIFWZFCNRPBN-KVQBGUIXSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(NC(=O)N=C32)N)CO)O |
Computed by PubChem (NCBI)