CAS 3080-29-3 appears in our catalog under these names: L-Adenosine, min. 95 %, 250 mg, L-Adenosine, 95%, L-Adenosine, >95% (HPLC), L–Adenosine, L-Adenosine. Offered by: Roth, Combi-blocks, TRC, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 10mg, 50mg, 500mg, 2000mg, 1000mg.
(2S,3S,4R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 3080-29-3) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 267.24 g/mol. IUPAC name: (2S,3S,4R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: OIRDTQYFTABQOQ-DEGSGYPDSA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | (2S,3S,4R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | OIRDTQYFTABQOQ-DEGSGYPDSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@@H]3[C@H]([C@H]([C@@H](O3)CO)O)O)N |
Computed by PubChem (NCBI)