CAS 13392-24-0 appears in our catalog under these names: Rhamnopterin, 95%, 6-(L-1,2,3 - Trihydroxybutyl) -pterin, 6-(L-1,2,3-Trihydroxybutyl)-pterin, Rhamnopterin. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 1mg, 5mg, 25mg, 50mg, 250mg, 500mg.
2-amino-6-(1,2,3-trihydroxybutyl)-3H-pteridin-4-one (CAS 13392-24-0) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 267.24 g/mol. IUPAC name: 2-amino-6-(1,2,3-trihydroxybutyl)-3H-pteridin-4-one. InChIKey: QSVZLFABRHDXRR-UHFFFAOYSA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 2-amino-6-(1,2,3-trihydroxybutyl)-3H-pteridin-4-one |
| InChIKey | QSVZLFABRHDXRR-UHFFFAOYSA-N |
| SMILES | CC(C(C(C1=CN=C2C(=N1)C(=O)NC(=N2)N)O)O)O |
Computed by PubChem (NCBI)