CAS 19316-85-9 appears in our catalog under these names: 5'-Azido-5'-deoxythymidine, 95%, 5-Azido-5-deoxy Thymidine, 5'-Azido-5'-deoxythymidine, 5’-Azido-(5’-deoxy)thymidine, 5′-Azido-5′-deoxythymidine, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, Creative Peptides, TRC, Biosynth. Available pack sizes: 100mg, 250mg, on request, 1g, 50mg, 25mg, 500mg, 50 mg.
1-[(2R,4S,5R)-5-(azidomethyl)-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 19316-85-9) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 267.24 g/mol. IUPAC name: 1-[(2R,4S,5R)-5-(azidomethyl)-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: GKEHVJFBPNPCKI-XLPZGREQSA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-5-(azidomethyl)-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | GKEHVJFBPNPCKI-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CN=[N+]=[N-])O |
Computed by PubChem (NCBI)