CAS 22837-44-1 appears in our catalog under these names: 2'-Deoxy-l-guanosine, 95%, 2'–Deoxy–L–guanosine, 2'-Deoxy-L-guanosine, 2'-Deoxy-L-guanosine 98%, 2'-Deoxy-L-guanosine, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 10mg, 5mg, 50mg, 200mg, 1000mg, 500mg.
2-amino-9-[(2S,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 22837-44-1) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 267.24 g/mol. IUPAC name: 2-amino-9-[(2S,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: YKBGVTZYEHREMT-SRQIZXRXSA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 2-amino-9-[(2S,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | YKBGVTZYEHREMT-SRQIZXRXSA-N |
| SMILES | C1[C@H]([C@@H](O[C@@H]1N2C=NC3=C2N=C(NC3=O)N)CO)O |
Computed by PubChem (NCBI)