CAS 1064662-53-8 appears in our catalog under these names: 2-[[4-Nitro-2-(phenylmethoxy)phenoxy]methyl]oxirane, 95%, 2-((2-(Benzyloxy)-4-nitrophenoxy)methyl)oxirane 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-[(4-nitro-2-phenylmethoxyphenoxy)methyl]oxirane (CAS 1064662-53-8) is a chemical compound with the molecular formula C16H15NO5 and a molecular weight of 301.29 g/mol. IUPAC name: 2-[(4-nitro-2-phenylmethoxyphenoxy)methyl]oxirane. InChIKey: JQPUUZRWDVLPNO-UHFFFAOYSA-N.
| Molecular formula | C16H15NO5 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | 2-[(4-nitro-2-phenylmethoxyphenoxy)methyl]oxirane |
| InChIKey | JQPUUZRWDVLPNO-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC2=C(C=C(C=C2)[N+](=O)[O-])OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)