Products 1428139-51-8
CAS 1428139-51-8 is the registry number for Methyl 7-(5-methyl-2-furyl)-2,5-dioxo-1,2,5,6,7,8-hexahydroquinoline-3-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 7-(5-methylfuran-2-yl)-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxylate (CAS 1428139-51-8) is a chemical compound with the molecular formula C16H15NO5 and a molecular weight of 301.29 g/mol. IUPAC name: methyl 7-(5-methylfuran-2-yl)-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxylate. InChIKey: FBRMLNWKLGPSKL-UHFFFAOYSA-N.
| Molecular formula | C16H15NO5 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | methyl 7-(5-methylfuran-2-yl)-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxylate |
| InChIKey | FBRMLNWKLGPSKL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C2CC3=C(C=C(C(=O)N3)C(=O)OC)C(=O)C2 |
Computed by PubChem (NCBI)