Products 893778-09-1
CAS 893778-09-1 is the registry number for Ethyl 3-amino-4-(1,3-benzodioxol-5-yloxy)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
Ethyl 3-amino-4-(1,3-benzodioxol-5-yloxy)benzoate (CAS 893778-09-1) is a chemical compound with the molecular formula C16H15NO5 and a molecular weight of 301.29 g/mol. IUPAC name: ethyl 3-amino-4-(1,3-benzodioxol-5-yloxy)benzoate. InChIKey: QUFSIDPXKMUZQP-UHFFFAOYSA-N.
| Molecular formula | C16H15NO5 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | ethyl 3-amino-4-(1,3-benzodioxol-5-yloxy)benzoate |
| InChIKey | QUFSIDPXKMUZQP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)OC2=CC3=C(C=C2)OCO3)N |
Computed by PubChem (NCBI)