Products 19368-27-5

CAS 19368-27-5 is the registry number for 2-((2,5-Dimethoxyphenyl)carbamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(2,5-dimethoxyphenyl)carbamoyl]benzoic acid (CAS 19368-27-5) is a chemical compound with the molecular formula C16H15NO5 and a molecular weight of 301.29 g/mol. IUPAC name: 2-[(2,5-dimethoxyphenyl)carbamoyl]benzoic acid. InChIKey: WVUKSBPGKNMXJS-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15NO5
Molecular weight301.29 g/mol
IUPAC name2-[(2,5-dimethoxyphenyl)carbamoyl]benzoic acid
InChIKeyWVUKSBPGKNMXJS-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)OC)NC(=O)C2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)