CAS 1065010-11-8 is the registry number for Methyl (E)-3-(6-nitrobenzo[d][1,3]dioxol-5-yl)acrylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate (CAS 1065010-11-8) is a chemical compound with the molecular formula C11H9NO6 and a molecular weight of 251.19 g/mol. IUPAC name: methyl (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate. InChIKey: TXYOYNRLFGCFCS-NSCUHMNNSA-N.
| Molecular formula | C11H9NO6 |
|---|---|
| Molecular weight | 251.19 g/mol |
| IUPAC name | methyl (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
| InChIKey | TXYOYNRLFGCFCS-NSCUHMNNSA-N |
| SMILES | COC(=O)/C=C/C1=CC2=C(C=C1[N+](=O)[O-])OCO2 |
Computed by PubChem (NCBI)