Products 773130-43-1
CAS 773130-43-1 is the registry number for (2E)-3-[4-(methoxycarbonyl)-2-nitrophenyl]prop-2-enoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(E)-3-(4-methoxycarbonyl-2-nitrophenyl)prop-2-enoic acid (CAS 773130-43-1) is a chemical compound with the molecular formula C11H9NO6 and a molecular weight of 251.19 g/mol. IUPAC name: (E)-3-(4-methoxycarbonyl-2-nitrophenyl)prop-2-enoic acid. InChIKey: OBXIHACULRGOCJ-SNAWJCMRSA-N.
| Molecular formula | C11H9NO6 |
|---|---|
| Molecular weight | 251.19 g/mol |
| IUPAC name | (E)-3-(4-methoxycarbonyl-2-nitrophenyl)prop-2-enoic acid |
| InChIKey | OBXIHACULRGOCJ-SNAWJCMRSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)/C=C/C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)