CAS 186371-01-7 is the registry number for 2,5-Dioxopyrrolidin-1-yl 2,4-dihydroxybenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,5-dioxopyrrolidin-1-yl) 2,4-dihydroxybenzoate (CAS 186371-01-7) is a chemical compound with the molecular formula C11H9NO6 and a molecular weight of 251.19 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2,4-dihydroxybenzoate. InChIKey: BYTXJVDUWGLIRW-UHFFFAOYSA-N.
| Molecular formula | C11H9NO6 |
|---|---|
| Molecular weight | 251.19 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2,4-dihydroxybenzoate |
| InChIKey | BYTXJVDUWGLIRW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=C(C=C(C=C2)O)O |
Computed by PubChem (NCBI)