Products 404840-87-5
CAS 404840-87-5 is the registry number for 2-((3-Carboxy-1-oxo-2-propenyl)amino)-5-hydroxybenzoic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-[[(E)-3-carboxyprop-2-enoyl]amino]-5-hydroxybenzoic acid (CAS 404840-87-5) is a chemical compound with the molecular formula C11H9NO6 and a molecular weight of 251.19 g/mol. IUPAC name: 2-[[(E)-3-carboxyprop-2-enoyl]amino]-5-hydroxybenzoic acid. InChIKey: WUBSGIATJRCIBE-ONEGZZNKSA-N.
| Molecular formula | C11H9NO6 |
|---|---|
| Molecular weight | 251.19 g/mol |
| IUPAC name | 2-[[(E)-3-carboxyprop-2-enoyl]amino]-5-hydroxybenzoic acid |
| InChIKey | WUBSGIATJRCIBE-ONEGZZNKSA-N |
| SMILES | C1=CC(=C(C=C1O)C(=O)O)NC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)