CAS 869472-63-9 appears in our catalog under these names: (2E)-3-(6-Nitro-4h-1,3-benzodioxin-8-yl)acrylic acid, 95%, (2E)-3-(6-Nitro-2,4-dihydro-1,3-benzodioxin-8-yl)prop-2-enoic acid, 95%, (2E)-3-(6-Nitro-2,4-dihydro-1,3-benzodioxin-8-yl)prop-2-enoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enoic acid (CAS 869472-63-9) is a chemical compound with the molecular formula C11H9NO6 and a molecular weight of 251.19 g/mol. IUPAC name: (E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enoic acid. InChIKey: MCPJKEKUWWGPCL-OWOJBTEDSA-N.
| Molecular formula | C11H9NO6 |
|---|---|
| Molecular weight | 251.19 g/mol |
| IUPAC name | (E)-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enoic acid |
| InChIKey | MCPJKEKUWWGPCL-OWOJBTEDSA-N |
| SMILES | C1C2=C(C(=CC(=C2)[N+](=O)[O-])/C=C/C(=O)O)OCO1 |
Computed by PubChem (NCBI)