CAS 1065074-12-5 appears in our catalog under these names: N,N-Dimethyl 4-bromo-3-methoxybenzamide, 97%, 4-Bromo-3-methoxy-N,N-dimethylbenzamide 98%, 4-Bromo-3-methoxy-N,N-dimethylbenzamide, 98%, 98%, 4-Bromo-3-methoxy-N,N-dimethylbenzamide, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
4-bromo-3-methoxy-N,N-dimethylbenzamide (CAS 1065074-12-5) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: 4-bromo-3-methoxy-N,N-dimethylbenzamide. InChIKey: RIDSVLNSIKUVKR-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 4-bromo-3-methoxy-N,N-dimethylbenzamide |
| InChIKey | RIDSVLNSIKUVKR-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=C(C=C1)Br)OC |
Computed by PubChem (NCBI)