Products 1065074-40-9
CAS 1065074-40-9 is the registry number for Methyl 2-amino-4-(2-chlorophenyl)thiazole-5-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Methyl 2-amino-4-(2-chlorophenyl)-1,3-thiazole-5-carboxylate (CAS 1065074-40-9) is a chemical compound with the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. IUPAC name: methyl 2-amino-4-(2-chlorophenyl)-1,3-thiazole-5-carboxylate. InChIKey: WWYGARGOAHUXKJ-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O2S |
|---|---|
| Molecular weight | 268.72 g/mol |
| IUPAC name | methyl 2-amino-4-(2-chlorophenyl)-1,3-thiazole-5-carboxylate |
| InChIKey | WWYGARGOAHUXKJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(S1)N)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)