Products 1189749-33-4

CAS 1189749-33-4 is the registry number for 2-[(2-Chlorobenzyl)amino]-1,3-thiazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[(2-chlorophenyl)methylamino]-1,3-thiazole-4-carboxylic acid (CAS 1189749-33-4) is a chemical compound with the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. IUPAC name: 2-[(2-chlorophenyl)methylamino]-1,3-thiazole-4-carboxylic acid. InChIKey: BAYKHTSRZKOZRZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9ClN2O2S
Molecular weight268.72 g/mol
IUPAC name2-[(2-chlorophenyl)methylamino]-1,3-thiazole-4-carboxylic acid
InChIKeyBAYKHTSRZKOZRZ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)CNC2=NC(=CS2)C(=O)O)Cl

Computed by PubChem (NCBI)