CAS 436094-79-0 appears in our catalog under these names: [2-(3-Chloro-phenylamino)-thiazol-4-yl]-acetic acid, 95%, 2-(2-((3-Chlorophenyl)amino)thiazol-4-yl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.
2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid (CAS 436094-79-0) is a chemical compound with the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. IUPAC name: 2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid. InChIKey: ANUTXYRPIOYFHW-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O2S |
|---|---|
| Molecular weight | 268.72 g/mol |
| IUPAC name | 2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | ANUTXYRPIOYFHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)