CAS 915873-63-1 appears in our catalog under these names: 4-(7-Chloro-2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine, 95%, 4-(7-Chloro-2,3-dihydrobenzo(b)(1,4)dioxin-6-yl)thiazol-2-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-1,3-thiazol-2-amine (CAS 915873-63-1) is a chemical compound with the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. IUPAC name: 4-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-1,3-thiazol-2-amine. InChIKey: UJRSOTQEMKMWCD-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O2S |
|---|---|
| Molecular weight | 268.72 g/mol |
| IUPAC name | 4-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-1,3-thiazol-2-amine |
| InChIKey | UJRSOTQEMKMWCD-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Cl)C3=CSC(=N3)N |
Computed by PubChem (NCBI)