CAS 465514-07-2 appears in our catalog under these names: 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride, 97%, 3–(2–Methylpyrimidin–4–yl)benzene–1–sulfonylchloride, 3-(2-Methyl-4-pyrimidinyl)benzenesulfonyl chloride, 95% , 3-(2-Methylpyrimidin-4-yl)benzenesulfonyl chloride, 95%, 3-(2-Methylpyrimidin-4-yl)benzene-1-sulfonylchloride, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific, Fluorochem, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
3-(2-methylpyrimidin-4-yl)benzenesulfonyl chloride (CAS 465514-07-2) is a chemical compound with the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. IUPAC name: 3-(2-methylpyrimidin-4-yl)benzenesulfonyl chloride. InChIKey: ZLLPUDLQNCNHFM-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O2S |
|---|---|
| Molecular weight | 268.72 g/mol |
| IUPAC name | 3-(2-methylpyrimidin-4-yl)benzenesulfonyl chloride |
| InChIKey | ZLLPUDLQNCNHFM-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=N1)C2=CC(=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)