CAS 1065074-78-3 is the registry number for N-Ethyl 5-bromopyridine-3-sulfonamide, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
5-bromo-N-ethylpyridine-3-sulfonamide (CAS 1065074-78-3) is a chemical compound with the molecular formula C7H9BrN2O2S and a molecular weight of 265.13 g/mol. IUPAC name: 5-bromo-N-ethylpyridine-3-sulfonamide. InChIKey: ILGAHUKGIGEEMU-UHFFFAOYSA-N.
| Molecular formula | C7H9BrN2O2S |
|---|---|
| Molecular weight | 265.13 g/mol |
| IUPAC name | 5-bromo-N-ethylpyridine-3-sulfonamide |
| InChIKey | ILGAHUKGIGEEMU-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)