CAS 896160-99-9 is the registry number for N,N-Dimethyl 5-bromopyridine-3-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-bromo-N,N-dimethylpyridine-3-sulfonamide (CAS 896160-99-9) is a chemical compound with the molecular formula C7H9BrN2O2S and a molecular weight of 265.13 g/mol. IUPAC name: 5-bromo-N,N-dimethylpyridine-3-sulfonamide. InChIKey: UHJBBAOJADKLCO-UHFFFAOYSA-N.
| Molecular formula | C7H9BrN2O2S |
|---|---|
| Molecular weight | 265.13 g/mol |
| IUPAC name | 5-bromo-N,N-dimethylpyridine-3-sulfonamide |
| InChIKey | UHJBBAOJADKLCO-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)