CAS 2570190-06-4 is the registry number for N-(2-Amino-3-bromophenyl)methanesulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 25g.
N-(2-amino-3-bromophenyl)methanesulfonamide (CAS 2570190-06-4) is a chemical compound with the molecular formula C7H9BrN2O2S and a molecular weight of 265.13 g/mol. IUPAC name: N-(2-amino-3-bromophenyl)methanesulfonamide. InChIKey: ZPQZDESTRXPNFU-UHFFFAOYSA-N.
| Molecular formula | C7H9BrN2O2S |
|---|---|
| Molecular weight | 265.13 g/mol |
| IUPAC name | N-(2-amino-3-bromophenyl)methanesulfonamide |
| InChIKey | ZPQZDESTRXPNFU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C(=CC=C1)Br)N |
Computed by PubChem (NCBI)