Products 1698150-87-6
CAS 1698150-87-6 is the registry number for N-(6-Bromo-2-methylpyridin-3-yl)methanesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(6-bromo-2-methyl-3-pyridinyl)methanesulfonamide (CAS 1698150-87-6) is a chemical compound with the molecular formula C7H9BrN2O2S and a molecular weight of 265.13 g/mol. IUPAC name: N-(6-bromo-2-methyl-3-pyridinyl)methanesulfonamide. InChIKey: WLUGJDGTFLYIBK-UHFFFAOYSA-N.
| Molecular formula | C7H9BrN2O2S |
|---|---|
| Molecular weight | 265.13 g/mol |
| IUPAC name | N-(6-bromo-2-methyl-3-pyridinyl)methanesulfonamide |
| InChIKey | WLUGJDGTFLYIBK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)Br)NS(=O)(=O)C |
Computed by PubChem (NCBI)