Products 2246371-02-6

CAS 2246371-02-6 is the registry number for 2-Bromo-4-ethyl-4H,6H-pyrazolo[1,5-c]thiazole 5,5-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-bromo-4-ethyl-4,6-dihydropyrazolo[1,5-c][1,3]thiazole 5,5-dioxide (CAS 2246371-02-6) is a chemical compound with the molecular formula C7H9BrN2O2S and a molecular weight of 265.13 g/mol. IUPAC name: 2-bromo-4-ethyl-4,6-dihydropyrazolo[1,5-c][1,3]thiazole 5,5-dioxide. InChIKey: IGFVVUJECWTKJK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9BrN2O2S
Molecular weight265.13 g/mol
IUPAC name2-bromo-4-ethyl-4,6-dihydropyrazolo[1,5-c][1,3]thiazole 5,5-dioxide
InChIKeyIGFVVUJECWTKJK-UHFFFAOYSA-N
SMILESCCC1C2=CC(=NN2CS1(=O)=O)Br

Computed by PubChem (NCBI)