CAS 106593-48-0 appears in our catalog under these names: 3-Hydroxy-4-phenylbenzoic acid, 98%, 3-Hydroxy-4-phenylbenzoic Acid, >95% (HPLC). Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg, 25mg.
3-hydroxy-4-phenylbenzoic acid (CAS 106593-48-0) is a chemical compound with the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. IUPAC name: 3-hydroxy-4-phenylbenzoic acid. InChIKey: DSADESJTZDXCPN-UHFFFAOYSA-N.
| Molecular formula | C13H10O3 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 3-hydroxy-4-phenylbenzoic acid |
| InChIKey | DSADESJTZDXCPN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)C(=O)O)O |
Computed by PubChem (NCBI)