CAS 323-87-5 appears in our catalog under these names: 4-Hydroxy-[1,1'-biphenyl]-3-carboxylic acid, 96%, 4–Hydroxy–(1,1'–biphenyl)–3–carboxylic acid, 4-Hydroxy-[1,1'-biphenyl]-3-carboxylic acid 95%, 4-Hydroxy[1,1′-biphenyl]-3-carboxylic acid, 95%, 95%, 4-Hydroxy-[1,1'-biphenyl]-3-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg.
2-hydroxy-5-phenylbenzoic acid (CAS 323-87-5) is a chemical compound with the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. IUPAC name: 2-hydroxy-5-phenylbenzoic acid. InChIKey: LGERKUYJCZOBTB-UHFFFAOYSA-N.
| Molecular formula | C13H10O3 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 2-hydroxy-5-phenylbenzoic acid |
| InChIKey | LGERKUYJCZOBTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)