CAS 121629-21-8 appears in our catalog under these names: 4'-Hydroxybiphenyl-3-carboxylic acid, 97%, 4'-Hydroxybiphenyl-3-carboxylic Acid, 4'-Hydroxy-(1,1'-biphenyl)-3-carboxylic acid, 98%, 4'-Hydroxy-biphenyl-3-carboxylic acid, 4'-Hydroxy-biphenyl-3-carboxylic acid, 97%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 0,5g, 500mg.
3-(4-hydroxyphenyl)benzoic acid (CAS 121629-21-8) is a chemical compound with the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. IUPAC name: 3-(4-hydroxyphenyl)benzoic acid. InChIKey: WINNQOZTIDYENK-UHFFFAOYSA-N.
| Molecular formula | C13H10O3 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 3-(4-hydroxyphenyl)benzoic acid |
| InChIKey | WINNQOZTIDYENK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)