CAS 171047-01-1 appears in our catalog under these names: 3'-Hydroxybiphenyl-3-carboxylic acid, 98%, 3'–Hydroxy–(1,1'–biphenyl)–3–carboxylic acid, 3'-Hydroxy-biphenyl-3-carboxylic acid, 3'-Hydroxy-[1,1'-biphenyl]-3-carboxylic acid 97%, 3'-Hydroxybiphenyl-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg.
3-(3-hydroxyphenyl)benzoic acid (CAS 171047-01-1) is a chemical compound with the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. IUPAC name: 3-(3-hydroxyphenyl)benzoic acid. InChIKey: CTFCUBMVYRSJLK-UHFFFAOYSA-N.
| Molecular formula | C13H10O3 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 3-(3-hydroxyphenyl)benzoic acid |
| InChIKey | CTFCUBMVYRSJLK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)