CAS 304-06-3 appears in our catalog under these names: 3–Phenylsalicylic Acid, 3-Phenylsalicylic acid, 95%, 3-Phenylsalicylic Acid, >98.0%(T), 2-Hydroxy-[1,1'-biphenyl]-3-carboxylic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, TCI, Chemat. Available pack sizes: 1g, 25g, 5g, 100g, 100mg, 250mg.
2-hydroxy-3-phenylbenzoic acid (CAS 304-06-3) is a chemical compound with the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. IUPAC name: 2-hydroxy-3-phenylbenzoic acid. InChIKey: ZJWUEJOPKFYFQD-UHFFFAOYSA-N.
| Molecular formula | C13H10O3 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 2-hydroxy-3-phenylbenzoic acid |
| InChIKey | ZJWUEJOPKFYFQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=CC=C2)C(=O)O)O |
Computed by PubChem (NCBI)