CAS 1067230-84-5 is the registry number for (R)-(1,4-Dioxan-2-yl)methyl 4-methylbenzenesulfonate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[(2R)-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate (CAS 1067230-84-5) is a chemical compound with the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. IUPAC name: [(2R)-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate. InChIKey: JOMHMWCSNNGYNP-LLVKDONJSA-N.
| Molecular formula | C12H16O5S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | [(2R)-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | JOMHMWCSNNGYNP-LLVKDONJSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@H]2COCCO2 |
Computed by PubChem (NCBI)