CAS 1067239-17-1 appears in our catalog under these names: 3-((tert-Butoxycarbonyl)amino)-1-hydroxycyclobutane-1-carboxylic acid, 98%, 3-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-hydroxycyclobutanecarboxylic acid, 98%, 98%, 3-((tert-Butoxycarbonyl)amino)-1-hydroxycyclobutanecarboxylic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg, 500mg.
1-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 1067239-17-1) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: 1-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: VKJURBPNHWOHDW-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 1-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | VKJURBPNHWOHDW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC(C1)(C(=O)O)O |
Computed by PubChem (NCBI)