CAS 1067613-97-1 appears in our catalog under these names: 4-(1-Methyl-1H-1,2,4-triazol-5-yl)benzoic acid, 97%, 4-(1-Methyl-1H-1,2,4-triazol-5-yl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(2-methyl-1,2,4-triazol-3-yl)benzoic acid (CAS 1067613-97-1) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 4-(2-methyl-1,2,4-triazol-3-yl)benzoic acid. InChIKey: DQWAODQLNJKZFA-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 4-(2-methyl-1,2,4-triazol-3-yl)benzoic acid |
| InChIKey | DQWAODQLNJKZFA-UHFFFAOYSA-N |
| SMILES | CN1C(=NC=N1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)