Products 106788-06-1

CAS 106788-06-1 is the registry number for 5-(1-Methoxypropyl)furan-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(1-methoxypropyl)furan-2-carboxylic acid (CAS 106788-06-1) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: 5-(1-methoxypropyl)furan-2-carboxylic acid. InChIKey: YXAHZTRQQSOWEC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12O4
Molecular weight184.19 g/mol
IUPAC name5-(1-methoxypropyl)furan-2-carboxylic acid
InChIKeyYXAHZTRQQSOWEC-UHFFFAOYSA-N
SMILESCCC(C1=CC=C(O1)C(=O)O)OC

Computed by PubChem (NCBI)