Products 106817-52-1
CAS 106817-52-1 appears in our catalog under these names: Felbamate–d4, Felbamate-d4, Felbamate-d4, >95% (HPLC), Felbamate-d4, 99.00%. Offered by: GLPBio, Chemat Brand, TRC, MedChemExpress. Available pack sizes: 1mg, on request, 50mg, 5mg, 500μg, 1 mg.
(3-carbamoyloxy-1,1,3,3-tetradeuterio-2-phenylpropyl) carbamate (CAS 106817-52-1) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 242.26 g/mol. IUPAC name: (3-carbamoyloxy-1,1,3,3-tetradeuterio-2-phenylpropyl) carbamate. InChIKey: WKGXYQFOCVYPAC-KXGHAPEVSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 242.26 g/mol |
| IUPAC name | (3-carbamoyloxy-1,1,3,3-tetradeuterio-2-phenylpropyl) carbamate |
| InChIKey | WKGXYQFOCVYPAC-KXGHAPEVSA-N |
| SMILES | [2H]C([2H])(C(C1=CC=CC=C1)C([2H])([2H])OC(=O)N)OC(=O)N |
Computed by PubChem (NCBI)