CAS 1191888-51-3 is the registry number for Felbamate-d5. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 1 mg.
[3-carbamoyloxy-2-(2,3,4,5,6-pentadeuteriophenyl)propyl] carbamate (CAS 1191888-51-3) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 243.27 g/mol. IUPAC name: [3-carbamoyloxy-2-(2,3,4,5,6-pentadeuteriophenyl)propyl] carbamate. InChIKey: WKGXYQFOCVYPAC-RALIUCGRSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 243.27 g/mol |
| IUPAC name | [3-carbamoyloxy-2-(2,3,4,5,6-pentadeuteriophenyl)propyl] carbamate |
| InChIKey | WKGXYQFOCVYPAC-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(COC(=O)N)COC(=O)N)[2H])[2H] |
Computed by PubChem (NCBI)