CAS 106833-78-7 is the registry number for 2-(Thiophen-2-yl)oxazole-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-thiophen-2-yl-1,3-oxazole-5-carbaldehyde (CAS 106833-78-7) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 2-thiophen-2-yl-1,3-oxazole-5-carbaldehyde. InChIKey: ZCNJCHIVOXADMC-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 2-thiophen-2-yl-1,3-oxazole-5-carbaldehyde |
| InChIKey | ZCNJCHIVOXADMC-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC=C(O2)C=O |
Computed by PubChem (NCBI)