Products 1069115-16-7
CAS 1069115-16-7 is the registry number for Methyl 2-(2-bromo-5-(trifluoromethyl)phenyl)acetate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-[2-bromo-5-(trifluoromethyl)phenyl]acetate (CAS 1069115-16-7) is a chemical compound with the molecular formula C10H8BrF3O2 and a molecular weight of 297.07 g/mol. IUPAC name: methyl 2-[2-bromo-5-(trifluoromethyl)phenyl]acetate. InChIKey: KDILYTLSFXYMOU-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O2 |
|---|---|
| Molecular weight | 297.07 g/mol |
| IUPAC name | methyl 2-[2-bromo-5-(trifluoromethyl)phenyl]acetate |
| InChIKey | KDILYTLSFXYMOU-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=CC(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)