Products 68755-36-2
CAS 68755-36-2 appears in our catalog under these names: 3–(2–Bromo–4–(trifluoromethyl)phenyl)propanoic acid, 3-(2-Bromo-4-(trifluoromethyl)phenyl)propanoic acid, 95%, 3-(2-Bromo-4-(trifluoromethyl)phenyl)propanoic acid 97%, 3-(2-Bromo-4-(trifluoromethyl)phenyl)propanoic acid, 97%, 97%, 3-(2-Bromo-4-(trifluoromethyl)phenyl)propanoic acid, 97%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-[2-bromo-4-(trifluoromethyl)phenyl]propanoic acid (CAS 68755-36-2) is a chemical compound with the molecular formula C10H8BrF3O2 and a molecular weight of 297.07 g/mol. IUPAC name: 3-[2-bromo-4-(trifluoromethyl)phenyl]propanoic acid. InChIKey: VLXQANRLIUVBKP-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O2 |
|---|---|
| Molecular weight | 297.07 g/mol |
| IUPAC name | 3-[2-bromo-4-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | VLXQANRLIUVBKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)CCC(=O)O |
Computed by PubChem (NCBI)