CAS 2169687-24-3 appears in our catalog under these names: 2-[2-Bromo-3-(trifluoromethyl)phenyl]-1,3-dioxolane, 95%, 2-[2-Bromo-3-(trifluoromethyl)phenyl]-1,3-dioxolane, ≥99.7%, ≥99.7%, 2-[2-Bromo-3-(trifluoromethyl)phenyl]-1,3-dioxolane, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
2-[2-bromo-3-(trifluoromethyl)phenyl]-1,3-dioxolane (CAS 2169687-24-3) is a chemical compound with the molecular formula C10H8BrF3O2 and a molecular weight of 297.07 g/mol. IUPAC name: 2-[2-bromo-3-(trifluoromethyl)phenyl]-1,3-dioxolane. InChIKey: KVIYOTWTYVTTPD-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O2 |
|---|---|
| Molecular weight | 297.07 g/mol |
| IUPAC name | 2-[2-bromo-3-(trifluoromethyl)phenyl]-1,3-dioxolane |
| InChIKey | KVIYOTWTYVTTPD-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C(=CC=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)