Products 1261439-45-5
CAS 1261439-45-5 is the registry number for 4-Bromo-2-propanoyl-1-(trifluoromethoxy)benzene, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
1-[5-bromo-2-(trifluoromethoxy)phenyl]propan-1-one (CAS 1261439-45-5) is a chemical compound with the molecular formula C10H8BrF3O2 and a molecular weight of 297.07 g/mol. IUPAC name: 1-[5-bromo-2-(trifluoromethoxy)phenyl]propan-1-one. InChIKey: XBWOEZQMXBRJDF-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O2 |
|---|---|
| Molecular weight | 297.07 g/mol |
| IUPAC name | 1-[5-bromo-2-(trifluoromethoxy)phenyl]propan-1-one |
| InChIKey | XBWOEZQMXBRJDF-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=CC(=C1)Br)OC(F)(F)F |
Computed by PubChem (NCBI)