Products 1214378-94-5
CAS 1214378-94-5 appears in our catalog under these names: 4-Bromo-2-(trifluoromethyl)benzoic acid ethyl ester, 95%, Ethyl 4-bromo-2-(trifluoromethyl)benzoate, 97%, 4-Bromo-2-(trifluoromethyl)benzoic acid ethyl ester. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl 4-bromo-2-(trifluoromethyl)benzoate (CAS 1214378-94-5) is a chemical compound with the molecular formula C10H8BrF3O2 and a molecular weight of 297.07 g/mol. IUPAC name: ethyl 4-bromo-2-(trifluoromethyl)benzoate. InChIKey: IDRJGROUCVPDJX-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O2 |
|---|---|
| Molecular weight | 297.07 g/mol |
| IUPAC name | ethyl 4-bromo-2-(trifluoromethyl)benzoate |
| InChIKey | IDRJGROUCVPDJX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)