Products 106967-74-2

CAS 106967-74-2 appears in our catalog under these names: (3-Methoxyphenoxy)acetyl chloride, 95%, (3-Methoxyphenoxy)acetyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-methoxyphenoxy)acetyl chloride (CAS 106967-74-2) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 2-(3-methoxyphenoxy)acetyl chloride. InChIKey: TVVBVERHHKVWFG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO3
Molecular weight200.62 g/mol
IUPAC name2-(3-methoxyphenoxy)acetyl chloride
InChIKeyTVVBVERHHKVWFG-UHFFFAOYSA-N
SMILESCOC1=CC(=CC=C1)OCC(=O)Cl

Computed by PubChem (NCBI)